C11H13N3O3 — CID 82562607
methyl 2-[(6-methoxy-1H-benzimidazol-2-yl)amino]acetate (PubChem CID 82562607) has the molecular formula C11H13N3O3 and a molecular weight of 235.24 g/mol. Its IUPAC name is methyl 2-[(6-methoxy-1H-benzimidazol-2-yl)amino]acetate.
| Compound Name | methyl 2-[(6-methoxy-1H-benzimidazol-2-yl)amino]acetate |
|---|---|
| PubChem CID | 82562607 |
| Molecular Formula | C11H13N3O3 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | methyl 2-[(6-methoxy-1H-benzimidazol-2-yl)amino]acetate |
| SMILES | COC(=O)CNc1nc2ccc(OC)cc2[nH]1 |
| InChI | InChI=1S/C11H13N3O3/c1-16-7-3-4-8-9(5-7)14-11(13-8)12-6-10(15)17-2/h3-5H,6H2,1-2H3,(H2,12,13,14) |
| InChIKey | LQRKWAKIUWWOQB-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |