About N-cyclopentyl-6-(1,3-thiazol-2-yl)-1H-benzimidazol-2-amine
N-cyclopentyl-6-(1,3-thiazol-2-yl)-1H-benzimidazol-2-amine (PubChem CID 82563289) has the molecular formula C15H16N4S
and a molecular weight of 284.39 g/mol. Its IUPAC name is N-cyclopentyl-6-(1,3-thiazol-2-yl)-1H-benzimidazol-2-amine.
Molecular Properties
| Compound Name | N-cyclopentyl-6-(1,3-thiazol-2-yl)-1H-benzimidazol-2-amine |
| PubChem CID | 82563289 |
| Molecular Formula | C15H16N4S |
| Molecular Weight | 284.39 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | N-cyclopentyl-6-(1,3-thiazol-2-yl)-1H-benzimidazol-2-amine |
| SMILES | c1csc(-c2ccc3nc(NC4CCCC4)[nH]c3c2)n1 |
| InChI | InChI=1S/C15H16N4S/c1-2-4-11(3-1)17-15-18-12-6-5-10(9-13(12)19-15)14-16-7-8-20-14/h5-9,11H,1-4H2,(H2,17,18,19) |
| InChIKey | BZMSXTPQWPDOLG-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.39 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-cyclopentyl-6-(1,3-thiazol-2-yl)-1H-benzimidazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopentyl-6-(1,3-thiazol-2-yl)-1H-benzimidazol-2-amine?
The IUPAC name of N-cyclopentyl-6-(1,3-thiazol-2-yl)-1H-benzimidazol-2-amine (CID 82563289) is N-cyclopentyl-6-(1,3-thiazol-2-yl)-1H-benzimidazol-2-amine.
What is the SMILES notation for N-cyclopentyl-6-(1,3-thiazol-2-yl)-1H-benzimidazol-2-amine?
The canonical SMILES for N-cyclopentyl-6-(1,3-thiazol-2-yl)-1H-benzimidazol-2-amine is c1csc(-c2ccc3nc(NC4CCCC4)[nH]c3c2)n1.
What is the InChIKey of N-cyclopentyl-6-(1,3-thiazol-2-yl)-1H-benzimidazol-2-amine?
The InChIKey is BZMSXTPQWPDOLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N4S/c1-2-4-11(3-1)17-15-18-12-6-5-10(9-13(12)19-15)14-16-7-8-20-14/h5-9,11H,1-4H2,(H2,17,18,19).
What are the key properties of N-cyclopentyl-6-(1,3-thiazol-2-yl)-1H-benzimidazol-2-amine?
N-cyclopentyl-6-(1,3-thiazol-2-yl)-1H-benzimidazol-2-amine has a molecular weight of 284.39 g/mol, XLogP of 4.04, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopentyl-6-(1,3-thiazol-2-yl)-1H-benzimidazol-2-amine is sourced from PubChem (CID 82563289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).