C14H12N4S — CID 82565759
5-methyl-2-phenyl-[1,2,4]triazolo[1,5-a]pyridine-8-carbothioamide (PubChem CID 82565759) has the molecular formula C14H12N4S and a molecular weight of 268.35 g/mol. Its IUPAC name is 5-methyl-2-phenyl-[1,2,4]triazolo[1,5-a]pyridine-8-carbothioamide.
| Compound Name | 5-methyl-2-phenyl-[1,2,4]triazolo[1,5-a]pyridine-8-carbothioamide |
|---|---|
| PubChem CID | 82565759 |
| Molecular Formula | C14H12N4S |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 5-methyl-2-phenyl-[1,2,4]triazolo[1,5-a]pyridine-8-carbothioamide |
| SMILES | Cc1ccc(C(N)=S)c2nc(-c3ccccc3)nn12 |
| InChI | InChI=1S/C14H12N4S/c1-9-7-8-11(12(15)19)14-16-13(17-18(9)14)10-5-3-2-4-6-10/h2-8H,1H3,(H2,15,19) |
| InChIKey | TVLVEZWNXAUHLF-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|