C16H18N6S — CID 82565773
2-[2-(dimethylamino)ethyl]-5-pyridin-4-yl-[1,2,4]triazolo[1,5-a]pyridine-8-carbothioamide (PubChem CID 82565773) has the molecular formula C16H18N6S and a molecular weight of 326.43 g/mol. Its IUPAC name is 2-[2-(dimethylamino)ethyl]-5-pyridin-4-yl-[1,2,4]triazolo[1,5-a]pyridine-8-carbothioamide.
| Compound Name | 2-[2-(dimethylamino)ethyl]-5-pyridin-4-yl-[1,2,4]triazolo[1,5-a]pyridine-8-carbothioamide |
|---|---|
| PubChem CID | 82565773 |
| Molecular Formula | C16H18N6S |
| Molecular Weight | 326.43 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 2-[2-(dimethylamino)ethyl]-5-pyridin-4-yl-[1,2,4]triazolo[1,5-a]pyridine-8-carbothioamide |
| SMILES | CN(C)CCc1nc2c(C(N)=S)ccc(-c3ccncc3)n2n1 |
| InChI | InChI=1S/C16H18N6S/c1-21(2)10-7-14-19-16-12(15(17)23)3-4-13(22(16)20-14)11-5-8-18-9-6-11/h3-6,8-9H,7,10H2,1-2H3,(H2,17,23) |
| InChIKey | HUXBWUSNMMJKPC-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 72.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.43 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|