C19H15N5 — CID 82565894
2,6-diphenyl-[1,2,4]triazolo[1,5-a]pyridine-8-carboximidamide (PubChem CID 82565894) has the molecular formula C19H15N5 and a molecular weight of 313.36 g/mol. Its IUPAC name is 2,6-diphenyl-[1,2,4]triazolo[1,5-a]pyridine-8-carboximidamide.
| Compound Name | 2,6-diphenyl-[1,2,4]triazolo[1,5-a]pyridine-8-carboximidamide |
|---|---|
| PubChem CID | 82565894 |
| Molecular Formula | C19H15N5 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 2,6-diphenyl-[1,2,4]triazolo[1,5-a]pyridine-8-carboximidamide |
| SMILES | [H]/N=C(\N)c1cc(-c2ccccc2)cn2nc(-c3ccccc3)nc12 |
| InChI | InChI=1S/C19H15N5/c20-17(21)16-11-15(13-7-3-1-4-8-13)12-24-19(16)22-18(23-24)14-9-5-2-6-10-14/h1-12H,(H3,20,21) |
| InChIKey | JELYIBWMTAAISK-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 80.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|