C17H25N5 — CID 82566163
2-[8-(aminomethyl)-5-phenyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-N,N-dimethylethanamine (PubChem CID 82566163) has the molecular formula C17H25N5 and a molecular weight of 299.42 g/mol. Its IUPAC name is 2-[8-(aminomethyl)-5-phenyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-N,N-dimethylethanamine.
| Compound Name | 2-[8-(aminomethyl)-5-phenyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 82566163 |
| Molecular Formula | C17H25N5 |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.21 |
| IUPAC Name | 2-[8-(aminomethyl)-5-phenyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-N,N-dimethylethanamine |
| SMILES | CN(C)CCc1nc2n(n1)C(c1ccccc1)CCC2CN |
| InChI | InChI=1S/C17H25N5/c1-21(2)11-10-16-19-17-14(12-18)8-9-15(22(17)20-16)13-6-4-3-5-7-13/h3-7,14-15H,8-12,18H2,1-2H3 |
| InChIKey | JYZKUXMSBJRGKA-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |