About 2-(aminomethyl)-[1,2,4]triazolo[1,5-a]pyridin-8-amine
2-(aminomethyl)-[1,2,4]triazolo[1,5-a]pyridin-8-amine (PubChem CID 82566665) has the molecular formula C7H9N5
and a molecular weight of 163.18 g/mol. Its IUPAC name is 2-(aminomethyl)-[1,2,4]triazolo[1,5-a]pyridin-8-amine.
Molecular Properties
| Compound Name | 2-(aminomethyl)-[1,2,4]triazolo[1,5-a]pyridin-8-amine |
| PubChem CID | 82566665 |
| Molecular Formula | C7H9N5 |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.09 |
| IUPAC Name | 2-(aminomethyl)-[1,2,4]triazolo[1,5-a]pyridin-8-amine |
| SMILES | NCc1nc2c(N)cccn2n1 |
| InChI | InChI=1S/C7H9N5/c8-4-6-10-7-5(9)2-1-3-12(7)11-6/h1-3H,4,8-9H2 |
| InChIKey | PUVYFJKSJFYHCU-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 82.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(aminomethyl)-[1,2,4]triazolo[1,5-a]pyridin-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(aminomethyl)-[1,2,4]triazolo[1,5-a]pyridin-8-amine?
The IUPAC name of 2-(aminomethyl)-[1,2,4]triazolo[1,5-a]pyridin-8-amine (CID 82566665) is 2-(aminomethyl)-[1,2,4]triazolo[1,5-a]pyridin-8-amine.
What is the SMILES notation for 2-(aminomethyl)-[1,2,4]triazolo[1,5-a]pyridin-8-amine?
The canonical SMILES for 2-(aminomethyl)-[1,2,4]triazolo[1,5-a]pyridin-8-amine is NCc1nc2c(N)cccn2n1.
What is the InChIKey of 2-(aminomethyl)-[1,2,4]triazolo[1,5-a]pyridin-8-amine?
The InChIKey is PUVYFJKSJFYHCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N5/c8-4-6-10-7-5(9)2-1-3-12(7)11-6/h1-3H,4,8-9H2.
What are the key properties of 2-(aminomethyl)-[1,2,4]triazolo[1,5-a]pyridin-8-amine?
2-(aminomethyl)-[1,2,4]triazolo[1,5-a]pyridin-8-amine has a molecular weight of 163.18 g/mol, XLogP of -0.23, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(aminomethyl)-[1,2,4]triazolo[1,5-a]pyridin-8-amine is sourced from PubChem (CID 82566665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).