C8H5Cl2N3O2 — CID 82566850
2-(dichloromethyl)-[1,2,4]triazolo[1,5-a]pyridine-6-carboxylic acid (PubChem CID 82566850) has the molecular formula C8H5Cl2N3O2 and a molecular weight of 246.05 g/mol. Its IUPAC name is 2-(dichloromethyl)-[1,2,4]triazolo[1,5-a]pyridine-6-carboxylic acid.
| Compound Name | 2-(dichloromethyl)-[1,2,4]triazolo[1,5-a]pyridine-6-carboxylic acid |
|---|---|
| PubChem CID | 82566850 |
| Molecular Formula | C8H5Cl2N3O2 |
| Molecular Weight | 246.05 g/mol |
| Exact Mass | 244.98 |
| IUPAC Name | 2-(dichloromethyl)-[1,2,4]triazolo[1,5-a]pyridine-6-carboxylic acid |
| SMILES | O=C(O)c1ccc2nc(C(Cl)Cl)nn2c1 |
| InChI | InChI=1S/C8H5Cl2N3O2/c9-6(10)7-11-5-2-1-4(8(14)15)3-13(5)12-7/h1-3,6H,(H,14,15) |
| InChIKey | ASMJOVSWVJHHQQ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 67.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.05 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|