C14H17N3S — CID 82567490
2-[(2-methylsulfanylphenyl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 82567490) has the molecular formula C14H17N3S and a molecular weight of 259.38 g/mol. Its IUPAC name is 2-[(2-methylsulfanylphenyl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 2-[(2-methylsulfanylphenyl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 82567490 |
| Molecular Formula | C14H17N3S |
| Molecular Weight | 259.38 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | 2-[(2-methylsulfanylphenyl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | CSc1ccccc1Cc1nc2n(n1)CCCC2 |
| InChI | InChI=1S/C14H17N3S/c1-18-12-7-3-2-6-11(12)10-13-15-14-8-4-5-9-17(14)16-13/h2-3,6-7H,4-5,8-10H2,1H3 |
| InChIKey | JRVOMUUQSVUKOK-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.38 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |