C10H16N4 — CID 82567991
(2-cyclopropyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-7-yl)methanamine (PubChem CID 82567991) has the molecular formula C10H16N4 and a molecular weight of 192.27 g/mol. Its IUPAC name is (2-cyclopropyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-7-yl)methanamine.
| Compound Name | (2-cyclopropyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-7-yl)methanamine |
|---|---|
| PubChem CID | 82567991 |
| Molecular Formula | C10H16N4 |
| Molecular Weight | 192.27 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | (2-cyclopropyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-7-yl)methanamine |
| SMILES | NCC1CCn2nc(C3CC3)nc2C1 |
| InChI | InChI=1S/C10H16N4/c11-6-7-3-4-14-9(5-7)12-10(13-14)8-1-2-8/h7-8H,1-6,11H2 |
| InChIKey | CAFZYRDSBUQBBQ-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.27 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |