C8H15N5 — CID 82568058
[2-(aminomethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]methanamine (PubChem CID 82568058) has the molecular formula C8H15N5 and a molecular weight of 181.24 g/mol. Its IUPAC name is [2-(aminomethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]methanamine.
| Compound Name | [2-(aminomethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]methanamine |
|---|---|
| PubChem CID | 82568058 |
| Molecular Formula | C8H15N5 |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.13 |
| IUPAC Name | [2-(aminomethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]methanamine |
| SMILES | NCc1nc2n(n1)CC(CN)CC2 |
| InChI | InChI=1S/C8H15N5/c9-3-6-1-2-8-11-7(4-10)12-13(8)5-6/h6H,1-5,9-10H2 |
| InChIKey | AAASOXPMAJOJHL-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |