C9H16N4 — CID 82568060
(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)methanamine (PubChem CID 82568060) has the molecular formula C9H16N4 and a molecular weight of 180.25 g/mol. Its IUPAC name is (2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)methanamine.
| Compound Name | (2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)methanamine |
|---|---|
| PubChem CID | 82568060 |
| Molecular Formula | C9H16N4 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.14 |
| IUPAC Name | (2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)methanamine |
| SMILES | CCc1nc2n(n1)CC(CN)CC2 |
| InChI | InChI=1S/C9H16N4/c1-2-8-11-9-4-3-7(5-10)6-13(9)12-8/h7H,2-6,10H2,1H3 |
| InChIKey | VLQUTKORQABFFI-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |