C14H18N4O — CID 82568144
4-[[5-(aminomethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl]methyl]phenol (PubChem CID 82568144) has the molecular formula C14H18N4O and a molecular weight of 258.32 g/mol. Its IUPAC name is 4-[[5-(aminomethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl]methyl]phenol.
| Compound Name | 4-[[5-(aminomethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl]methyl]phenol |
|---|---|
| PubChem CID | 82568144 |
| Molecular Formula | C14H18N4O |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | 4-[[5-(aminomethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl]methyl]phenol |
| SMILES | NCC1CCCc2nc(Cc3ccc(O)cc3)nn21 |
| InChI | InChI=1S/C14H18N4O/c15-9-11-2-1-3-14-16-13(17-18(11)14)8-10-4-6-12(19)7-5-10/h4-7,11,19H,1-3,8-9,15H2 |
| InChIKey | AGYPKXWHMOHTSW-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |