C14H21N5 — CID 82568274
4-[[3-(3-aminopropyl)-1H-1,2,4-triazol-5-yl]methyl]-N,N-dimethylaniline (PubChem CID 82568274) has the molecular formula C14H21N5 and a molecular weight of 259.36 g/mol. Its IUPAC name is 4-[[3-(3-aminopropyl)-1H-1,2,4-triazol-5-yl]methyl]-N,N-dimethylaniline.
| Compound Name | 4-[[3-(3-aminopropyl)-1H-1,2,4-triazol-5-yl]methyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 82568274 |
| Molecular Formula | C14H21N5 |
| Molecular Weight | 259.36 g/mol |
| Exact Mass | 259.18 |
| IUPAC Name | 4-[[3-(3-aminopropyl)-1H-1,2,4-triazol-5-yl]methyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(Cc2nc(CCCN)n[nH]2)cc1 |
| InChI | InChI=1S/C14H21N5/c1-19(2)12-7-5-11(6-8-12)10-14-16-13(17-18-14)4-3-9-15/h5-8H,3-4,9-10,15H2,1-2H3,(H,16,17,18) |
| InChIKey | DZKAUAZEVIQZLG-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.36 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|