C9H15F3N4 — CID 82568539
5-[5-(2,2,2-trifluoroethyl)-1H-1,2,4-triazol-3-yl]pentan-1-amine (PubChem CID 82568539) has the molecular formula C9H15F3N4 and a molecular weight of 236.24 g/mol. Its IUPAC name is 5-[5-(2,2,2-trifluoroethyl)-1H-1,2,4-triazol-3-yl]pentan-1-amine.
| Compound Name | 5-[5-(2,2,2-trifluoroethyl)-1H-1,2,4-triazol-3-yl]pentan-1-amine |
|---|---|
| PubChem CID | 82568539 |
| Molecular Formula | C9H15F3N4 |
| Molecular Weight | 236.24 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 5-[5-(2,2,2-trifluoroethyl)-1H-1,2,4-triazol-3-yl]pentan-1-amine |
| SMILES | NCCCCCc1n[nH]c(CC(F)(F)F)n1 |
| InChI | InChI=1S/C9H15F3N4/c10-9(11,12)6-8-14-7(15-16-8)4-2-1-3-5-13/h1-6,13H2,(H,14,15,16) |
| InChIKey | IONPPSNHCIPHCK-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.24 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|