C13H13N5S — CID 82568693
4-[[3-(1,3-thiazol-2-ylmethyl)-1H-1,2,4-triazol-5-yl]methyl]aniline (PubChem CID 82568693) has the molecular formula C13H13N5S and a molecular weight of 271.35 g/mol. Its IUPAC name is 4-[[3-(1,3-thiazol-2-ylmethyl)-1H-1,2,4-triazol-5-yl]methyl]aniline.
| Compound Name | 4-[[3-(1,3-thiazol-2-ylmethyl)-1H-1,2,4-triazol-5-yl]methyl]aniline |
|---|---|
| PubChem CID | 82568693 |
| Molecular Formula | C13H13N5S |
| Molecular Weight | 271.35 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | 4-[[3-(1,3-thiazol-2-ylmethyl)-1H-1,2,4-triazol-5-yl]methyl]aniline |
| SMILES | Nc1ccc(Cc2nc(Cc3nccs3)n[nH]2)cc1 |
| InChI | InChI=1S/C13H13N5S/c14-10-3-1-9(2-4-10)7-11-16-12(18-17-11)8-13-15-5-6-19-13/h1-6H,7-8,14H2,(H,16,17,18) |
| InChIKey | VFJXXJKHTRBMCS-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.35 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|