C13H16F2N4 — CID 82569314
5-[3-(3,4-difluorophenyl)-1H-1,2,4-triazol-5-yl]pentan-1-amine (PubChem CID 82569314) has the molecular formula C13H16F2N4 and a molecular weight of 266.30 g/mol. Its IUPAC name is 5-[3-(3,4-difluorophenyl)-1H-1,2,4-triazol-5-yl]pentan-1-amine.
| Compound Name | 5-[3-(3,4-difluorophenyl)-1H-1,2,4-triazol-5-yl]pentan-1-amine |
|---|---|
| PubChem CID | 82569314 |
| Molecular Formula | C13H16F2N4 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 5-[3-(3,4-difluorophenyl)-1H-1,2,4-triazol-5-yl]pentan-1-amine |
| SMILES | NCCCCCc1nc(-c2ccc(F)c(F)c2)n[nH]1 |
| InChI | InChI=1S/C13H16F2N4/c14-10-6-5-9(8-11(10)15)13-17-12(18-19-13)4-2-1-3-7-16/h5-6,8H,1-4,7,16H2,(H,17,18,19) |
| InChIKey | MXLPCZCXBMLNEX-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|