C18H21N5 — CID 82569333
5-[3-(4-pyridin-2-ylphenyl)-1H-1,2,4-triazol-5-yl]pentan-1-amine (PubChem CID 82569333) has the molecular formula C18H21N5 and a molecular weight of 307.40 g/mol. Its IUPAC name is 5-[3-(4-pyridin-2-ylphenyl)-1H-1,2,4-triazol-5-yl]pentan-1-amine.
| Compound Name | 5-[3-(4-pyridin-2-ylphenyl)-1H-1,2,4-triazol-5-yl]pentan-1-amine |
|---|---|
| PubChem CID | 82569333 |
| Molecular Formula | C18H21N5 |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | 5-[3-(4-pyridin-2-ylphenyl)-1H-1,2,4-triazol-5-yl]pentan-1-amine |
| SMILES | NCCCCCc1nc(-c2ccc(-c3ccccn3)cc2)n[nH]1 |
| InChI | InChI=1S/C18H21N5/c19-12-4-1-2-7-17-21-18(23-22-17)15-10-8-14(9-11-15)16-6-3-5-13-20-16/h3,5-6,8-11,13H,1-2,4,7,12,19H2,(H,21,22,23) |
| InChIKey | UXXMUNSFHKQNSE-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|