C18H21ClN4 — CID 82569499
5-[5-(1-adamantyl)-1H-1,2,4-triazol-3-yl]-2-chloroaniline (PubChem CID 82569499) has the molecular formula C18H21ClN4 and a molecular weight of 328.85 g/mol. Its IUPAC name is 5-[5-(1-adamantyl)-1H-1,2,4-triazol-3-yl]-2-chloroaniline.
| Compound Name | 5-[5-(1-adamantyl)-1H-1,2,4-triazol-3-yl]-2-chloroaniline |
|---|---|
| PubChem CID | 82569499 |
| Molecular Formula | C18H21ClN4 |
| Molecular Weight | 328.85 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | 5-[5-(1-adamantyl)-1H-1,2,4-triazol-3-yl]-2-chloroaniline |
| SMILES | Nc1cc(-c2n[nH]c(C34CC5CC(CC(C5)C3)C4)n2)ccc1Cl |
| InChI | InChI=1S/C18H21ClN4/c19-14-2-1-13(6-15(14)20)16-21-17(23-22-16)18-7-10-3-11(8-18)5-12(4-10)9-18/h1-2,6,10-12H,3-5,7-9,20H2,(H,21,22,23) |
| InChIKey | YDQYCDYBUILJKS-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.85 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|