C16H15ClN4O2 — CID 82569500
2-chloro-5-[5-(2,6-dimethoxyphenyl)-1H-1,2,4-triazol-3-yl]aniline (PubChem CID 82569500) has the molecular formula C16H15ClN4O2 and a molecular weight of 330.78 g/mol. Its IUPAC name is 2-chloro-5-[5-(2,6-dimethoxyphenyl)-1H-1,2,4-triazol-3-yl]aniline.
| Compound Name | 2-chloro-5-[5-(2,6-dimethoxyphenyl)-1H-1,2,4-triazol-3-yl]aniline |
|---|---|
| PubChem CID | 82569500 |
| Molecular Formula | C16H15ClN4O2 |
| Molecular Weight | 330.78 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | 2-chloro-5-[5-(2,6-dimethoxyphenyl)-1H-1,2,4-triazol-3-yl]aniline |
| SMILES | COc1cccc(OC)c1-c1nc(-c2ccc(Cl)c(N)c2)n[nH]1 |
| InChI | InChI=1S/C16H15ClN4O2/c1-22-12-4-3-5-13(23-2)14(12)16-19-15(20-21-16)9-6-7-10(17)11(18)8-9/h3-8H,18H2,1-2H3,(H,19,20,21) |
| InChIKey | BWLKDKMNOMSTAY-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 86.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.78 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|