C15H12FN3 — CID 82569923
1-N-(2-fluorophenyl)isoquinoline-1,8-diamine (PubChem CID 82569923) has the molecular formula C15H12FN3 and a molecular weight of 253.28 g/mol. Its IUPAC name is 1-N-(2-fluorophenyl)isoquinoline-1,8-diamine.
| Compound Name | 1-N-(2-fluorophenyl)isoquinoline-1,8-diamine |
|---|---|
| PubChem CID | 82569923 |
| Molecular Formula | C15H12FN3 |
| Molecular Weight | 253.28 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | 1-N-(2-fluorophenyl)isoquinoline-1,8-diamine |
| SMILES | Nc1cccc2ccnc(Nc3ccccc3F)c12 |
| InChI | InChI=1S/C15H12FN3/c16-11-5-1-2-7-13(11)19-15-14-10(8-9-18-15)4-3-6-12(14)17/h1-9H,17H2,(H,18,19) |
| InChIKey | ZPBUZIDEHGVRDX-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.28 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|