About 7-bromo-1-N-methylisoquinoline-1,5-diamine
7-bromo-1-N-methylisoquinoline-1,5-diamine (PubChem CID 82570476) has the molecular formula C10H10BrN3
and a molecular weight of 252.12 g/mol. Its IUPAC name is 7-bromo-1-N-methylisoquinoline-1,5-diamine.
Molecular Properties
| Compound Name | 7-bromo-1-N-methylisoquinoline-1,5-diamine |
| PubChem CID | 82570476 |
| Molecular Formula | C10H10BrN3 |
| Molecular Weight | 252.12 g/mol |
| Exact Mass | 251.01 |
| IUPAC Name | 7-bromo-1-N-methylisoquinoline-1,5-diamine |
| SMILES | CNc1nccc2c(N)cc(Br)cc12 |
| InChI | InChI=1S/C10H10BrN3/c1-13-10-8-4-6(11)5-9(12)7(8)2-3-14-10/h2-5H,12H2,1H3,(H,13,14) |
| InChIKey | RXNFQUBZZLPZCX-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.12 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 7-bromo-1-N-methylisoquinoline-1,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-1-N-methylisoquinoline-1,5-diamine?
The IUPAC name of 7-bromo-1-N-methylisoquinoline-1,5-diamine (CID 82570476) is 7-bromo-1-N-methylisoquinoline-1,5-diamine.
What is the SMILES notation for 7-bromo-1-N-methylisoquinoline-1,5-diamine?
The canonical SMILES for 7-bromo-1-N-methylisoquinoline-1,5-diamine is CNc1nccc2c(N)cc(Br)cc12.
What is the InChIKey of 7-bromo-1-N-methylisoquinoline-1,5-diamine?
The InChIKey is RXNFQUBZZLPZCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10BrN3/c1-13-10-8-4-6(11)5-9(12)7(8)2-3-14-10/h2-5H,12H2,1H3,(H,13,14).
What are the key properties of 7-bromo-1-N-methylisoquinoline-1,5-diamine?
7-bromo-1-N-methylisoquinoline-1,5-diamine has a molecular weight of 252.12 g/mol, XLogP of 2.62, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-1-N-methylisoquinoline-1,5-diamine is sourced from PubChem (CID 82570476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).