C12H10ClNO2 — CID 82574745
6-chloro-2,4-dimethylquinoline-8-carboxylic acid (PubChem CID 82574745) has the molecular formula C12H10ClNO2 and a molecular weight of 235.67 g/mol. Its IUPAC name is 6-chloro-2,4-dimethylquinoline-8-carboxylic acid.
| Compound Name | 6-chloro-2,4-dimethylquinoline-8-carboxylic acid |
|---|---|
| PubChem CID | 82574745 |
| Molecular Formula | C12H10ClNO2 |
| Molecular Weight | 235.67 g/mol |
| Exact Mass | 235.04 |
| IUPAC Name | 6-chloro-2,4-dimethylquinoline-8-carboxylic acid |
| SMILES | Cc1cc(C)c2cc(Cl)cc(C(=O)O)c2n1 |
| InChI | InChI=1S/C12H10ClNO2/c1-6-3-7(2)14-11-9(6)4-8(13)5-10(11)12(15)16/h3-5H,1-2H3,(H,15,16) |
| InChIKey | YDNLNWGUSNEEPY-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.67 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |