methyl 2-(4,6-dimethylquinolin-2-yl)acetate

C14H15NO2 — CID 82575101

IUPACmethyl 2-(4,6-dimethylquinolin-2-yl)acetate
SMILESCOC(=O)Cc1cc(C)c2cc(C)ccc2n1
InChIInChI=1S/C14H15NO2/c1-9-4-5-13-12(6-9)10(2)7-11(15-13)8-14(16)17-3/h4-7H,8H2,1-3H3
InChIKeySVHRKZPLQAFNRK-UHFFFAOYSA-N
MW229.28 g/mol
LogP2.57
Rot. Bonds2

About methyl 2-(4,6-dimethylquinolin-2-yl)acetate

methyl 2-(4,6-dimethylquinolin-2-yl)acetate (PubChem CID 82575101) has the molecular formula C14H15NO2 and a molecular weight of 229.28 g/mol. Its IUPAC name is methyl 2-(4,6-dimethylquinolin-2-yl)acetate.

Molecular Properties

Compound Namemethyl 2-(4,6-dimethylquinolin-2-yl)acetate
PubChem CID82575101
Molecular FormulaC14H15NO2
Molecular Weight229.28 g/mol
Exact Mass229.11
IUPAC Namemethyl 2-(4,6-dimethylquinolin-2-yl)acetate
SMILESCOC(=O)Cc1cc(C)c2cc(C)ccc2n1
InChIInChI=1S/C14H15NO2/c1-9-4-5-13-12(6-9)10(2)7-11(15-13)8-14(16)17-3/h4-7H,8H2,1-3H3
InChIKeySVHRKZPLQAFNRK-UHFFFAOYSA-N
XLogP2.57
TPSA39.19 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500229.28
LogP ≤ 52.57
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 2-(4,6-dimethylquinolin-2-yl)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(4,6-dimethylquinolin-2-yl)acetate?
The IUPAC name of methyl 2-(4,6-dimethylquinolin-2-yl)acetate (CID 82575101) is methyl 2-(4,6-dimethylquinolin-2-yl)acetate.
What is the SMILES notation for methyl 2-(4,6-dimethylquinolin-2-yl)acetate?
The canonical SMILES for methyl 2-(4,6-dimethylquinolin-2-yl)acetate is COC(=O)Cc1cc(C)c2cc(C)ccc2n1.
What is the InChIKey of methyl 2-(4,6-dimethylquinolin-2-yl)acetate?
The InChIKey is SVHRKZPLQAFNRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15NO2/c1-9-4-5-13-12(6-9)10(2)7-11(15-13)8-14(16)17-3/h4-7H,8H2,1-3H3.
What are the key properties of methyl 2-(4,6-dimethylquinolin-2-yl)acetate?
methyl 2-(4,6-dimethylquinolin-2-yl)acetate has a molecular weight of 229.28 g/mol, XLogP of 2.57, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(4,6-dimethylquinolin-2-yl)acetate is sourced from PubChem (CID 82575101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).