About 2-(5-chloro-4,8-dimethylquinolin-2-yl)ethanamine
2-(5-chloro-4,8-dimethylquinolin-2-yl)ethanamine (PubChem CID 82575558) has the molecular formula C13H15ClN2
and a molecular weight of 234.73 g/mol. Its IUPAC name is 2-(5-chloro-4,8-dimethylquinolin-2-yl)ethanamine.
Molecular Properties
| Compound Name | 2-(5-chloro-4,8-dimethylquinolin-2-yl)ethanamine |
| PubChem CID | 82575558 |
| Molecular Formula | C13H15ClN2 |
| Molecular Weight | 234.73 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 2-(5-chloro-4,8-dimethylquinolin-2-yl)ethanamine |
| SMILES | Cc1ccc(Cl)c2c(C)cc(CCN)nc12 |
| InChI | InChI=1S/C13H15ClN2/c1-8-3-4-11(14)12-9(2)7-10(5-6-15)16-13(8)12/h3-4,7H,5-6,15H2,1-2H3 |
| InChIKey | JRQWVTIXNLJJPD-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.73 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(5-chloro-4,8-dimethylquinolin-2-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-chloro-4,8-dimethylquinolin-2-yl)ethanamine?
The IUPAC name of 2-(5-chloro-4,8-dimethylquinolin-2-yl)ethanamine (CID 82575558) is 2-(5-chloro-4,8-dimethylquinolin-2-yl)ethanamine.
What is the SMILES notation for 2-(5-chloro-4,8-dimethylquinolin-2-yl)ethanamine?
The canonical SMILES for 2-(5-chloro-4,8-dimethylquinolin-2-yl)ethanamine is Cc1ccc(Cl)c2c(C)cc(CCN)nc12.
What is the InChIKey of 2-(5-chloro-4,8-dimethylquinolin-2-yl)ethanamine?
The InChIKey is JRQWVTIXNLJJPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15ClN2/c1-8-3-4-11(14)12-9(2)7-10(5-6-15)16-13(8)12/h3-4,7H,5-6,15H2,1-2H3.
What are the key properties of 2-(5-chloro-4,8-dimethylquinolin-2-yl)ethanamine?
2-(5-chloro-4,8-dimethylquinolin-2-yl)ethanamine has a molecular weight of 234.73 g/mol, XLogP of 3.01, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-chloro-4,8-dimethylquinolin-2-yl)ethanamine is sourced from PubChem (CID 82575558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).