C13H15ClN2 — CID 82575608
2-(6-chloro-2,8-dimethylquinolin-4-yl)ethanamine (PubChem CID 82575608) has the molecular formula C13H15ClN2 and a molecular weight of 234.73 g/mol. Its IUPAC name is 2-(6-chloro-2,8-dimethylquinolin-4-yl)ethanamine.
| Compound Name | 2-(6-chloro-2,8-dimethylquinolin-4-yl)ethanamine |
|---|---|
| PubChem CID | 82575608 |
| Molecular Formula | C13H15ClN2 |
| Molecular Weight | 234.73 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 2-(6-chloro-2,8-dimethylquinolin-4-yl)ethanamine |
| SMILES | Cc1cc(CCN)c2cc(Cl)cc(C)c2n1 |
| InChI | InChI=1S/C13H15ClN2/c1-8-5-11(14)7-12-10(3-4-15)6-9(2)16-13(8)12/h5-7H,3-4,15H2,1-2H3 |
| InChIKey | VTUQXBHEPBSKOA-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.73 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |