About (2E)-2-(5,7-dimethylindeno[1,2-b]thiophen-4-ylidene)acetic acid
(2E)-2-(5,7-dimethylindeno[1,2-b]thiophen-4-ylidene)acetic acid (PubChem CID 82578837) has the molecular formula C15H12O2S
and a molecular weight of 256.33 g/mol. Its IUPAC name is (2E)-2-(5,7-dimethylindeno[1,2-b]thiophen-4-ylidene)acetic acid.
Molecular Properties
| Compound Name | (2E)-2-(5,7-dimethylindeno[1,2-b]thiophen-4-ylidene)acetic acid |
| PubChem CID | 82578837 |
| Molecular Formula | C15H12O2S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | (2E)-2-(5,7-dimethylindeno[1,2-b]thiophen-4-ylidene)acetic acid |
| SMILES | Cc1cc(C)c2c(c1)-c1sccc1/C2=C/C(=O)O |
| InChI | InChI=1S/C15H12O2S/c1-8-5-9(2)14-11(7-13(16)17)10-3-4-18-15(10)12(14)6-8/h3-7H,1-2H3,(H,16,17)/b11-7- |
| InChIKey | VFRSHLOVEXTMKW-XFFZJAGNSA-N |
| XLogP | 3.86 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2E)-2-(5,7-dimethylindeno[1,2-b]thiophen-4-ylidene)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-(5,7-dimethylindeno[1,2-b]thiophen-4-ylidene)acetic acid?
The IUPAC name of (2E)-2-(5,7-dimethylindeno[1,2-b]thiophen-4-ylidene)acetic acid (CID 82578837) is (2E)-2-(5,7-dimethylindeno[1,2-b]thiophen-4-ylidene)acetic acid.
What is the SMILES notation for (2E)-2-(5,7-dimethylindeno[1,2-b]thiophen-4-ylidene)acetic acid?
The canonical SMILES for (2E)-2-(5,7-dimethylindeno[1,2-b]thiophen-4-ylidene)acetic acid is Cc1cc(C)c2c(c1)-c1sccc1/C2=C/C(=O)O.
What is the InChIKey of (2E)-2-(5,7-dimethylindeno[1,2-b]thiophen-4-ylidene)acetic acid?
The InChIKey is VFRSHLOVEXTMKW-XFFZJAGNSA-N. The full InChI is InChI=1S/C15H12O2S/c1-8-5-9(2)14-11(7-13(16)17)10-3-4-18-15(10)12(14)6-8/h3-7H,1-2H3,(H,16,17)/b11-7-.
What are the key properties of (2E)-2-(5,7-dimethylindeno[1,2-b]thiophen-4-ylidene)acetic acid?
(2E)-2-(5,7-dimethylindeno[1,2-b]thiophen-4-ylidene)acetic acid has a molecular weight of 256.33 g/mol, XLogP of 3.86, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-(5,7-dimethylindeno[1,2-b]thiophen-4-ylidene)acetic acid is sourced from PubChem (CID 82578837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).