C17H15FO2 — CID 82579030
2-(2-fluoro-5,6-dimethyl-9H-fluoren-9-yl)acetic acid (PubChem CID 82579030) has the molecular formula C17H15FO2 and a molecular weight of 270.30 g/mol. Its IUPAC name is 2-(2-fluoro-5,6-dimethyl-9H-fluoren-9-yl)acetic acid.
| Compound Name | 2-(2-fluoro-5,6-dimethyl-9H-fluoren-9-yl)acetic acid |
|---|---|
| PubChem CID | 82579030 |
| Molecular Formula | C17H15FO2 |
| Molecular Weight | 270.30 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | 2-(2-fluoro-5,6-dimethyl-9H-fluoren-9-yl)acetic acid |
| SMILES | Cc1ccc2c(c1C)-c1ccc(F)cc1C2CC(=O)O |
| InChI | InChI=1S/C17H15FO2/c1-9-3-5-12-15(8-16(19)20)14-7-11(18)4-6-13(14)17(12)10(9)2/h3-7,15H,8H2,1-2H3,(H,19,20) |
| InChIKey | BPEBKYVWZQQFCV-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.30 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |