2-(2-fluoro-5,6-dimethyl-9H-fluoren-9-yl)acetic acid

C17H15FO2 — CID 82579030

IUPAC2-(2-fluoro-5,6-dimethyl-9H-fluoren-9-yl)acetic acid
SMILESCc1ccc2c(c1C)-c1ccc(F)cc1C2CC(=O)O
InChIInChI=1S/C17H15FO2/c1-9-3-5-12-15(8-16(19)20)14-7-11(18)4-6-13(14)17(12)10(9)2/h3-7,15H,8H2,1-2H3,(H,19,20)
InChIKeyBPEBKYVWZQQFCV-UHFFFAOYSA-N
MW270.30 g/mol
LogP4.03
Rot. Bonds2

About 2-(2-fluoro-5,6-dimethyl-9H-fluoren-9-yl)acetic acid

2-(2-fluoro-5,6-dimethyl-9H-fluoren-9-yl)acetic acid (PubChem CID 82579030) has the molecular formula C17H15FO2 and a molecular weight of 270.30 g/mol. Its IUPAC name is 2-(2-fluoro-5,6-dimethyl-9H-fluoren-9-yl)acetic acid.

Molecular Properties

Compound Name2-(2-fluoro-5,6-dimethyl-9H-fluoren-9-yl)acetic acid
PubChem CID82579030
Molecular FormulaC17H15FO2
Molecular Weight270.30 g/mol
Exact Mass270.11
IUPAC Name2-(2-fluoro-5,6-dimethyl-9H-fluoren-9-yl)acetic acid
SMILESCc1ccc2c(c1C)-c1ccc(F)cc1C2CC(=O)O
InChIInChI=1S/C17H15FO2/c1-9-3-5-12-15(8-16(19)20)14-7-11(18)4-6-13(14)17(12)10(9)2/h3-7,15H,8H2,1-2H3,(H,19,20)
InChIKeyBPEBKYVWZQQFCV-UHFFFAOYSA-N
XLogP4.03
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500270.30
LogP ≤ 54.03
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 2-(2-fluoro-5,6-dimethyl-9H-fluoren-9-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2-fluoro-5,6-dimethyl-9H-fluoren-9-yl)acetic acid?
The IUPAC name of 2-(2-fluoro-5,6-dimethyl-9H-fluoren-9-yl)acetic acid (CID 82579030) is 2-(2-fluoro-5,6-dimethyl-9H-fluoren-9-yl)acetic acid.
What is the SMILES notation for 2-(2-fluoro-5,6-dimethyl-9H-fluoren-9-yl)acetic acid?
The canonical SMILES for 2-(2-fluoro-5,6-dimethyl-9H-fluoren-9-yl)acetic acid is Cc1ccc2c(c1C)-c1ccc(F)cc1C2CC(=O)O.
What is the InChIKey of 2-(2-fluoro-5,6-dimethyl-9H-fluoren-9-yl)acetic acid?
The InChIKey is BPEBKYVWZQQFCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15FO2/c1-9-3-5-12-15(8-16(19)20)14-7-11(18)4-6-13(14)17(12)10(9)2/h3-7,15H,8H2,1-2H3,(H,19,20).
What are the key properties of 2-(2-fluoro-5,6-dimethyl-9H-fluoren-9-yl)acetic acid?
2-(2-fluoro-5,6-dimethyl-9H-fluoren-9-yl)acetic acid has a molecular weight of 270.30 g/mol, XLogP of 4.03, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-fluoro-5,6-dimethyl-9H-fluoren-9-yl)acetic acid is sourced from PubChem (CID 82579030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).