C13H13Cl2NO — CID 82581132
2,4-dichloro-6-[(2-methylpropan-2-yl)oxy]quinoline (PubChem CID 82581132) has the molecular formula C13H13Cl2NO and a molecular weight of 270.16 g/mol. Its IUPAC name is 2,4-dichloro-6-[(2-methylpropan-2-yl)oxy]quinoline.
| Compound Name | 2,4-dichloro-6-[(2-methylpropan-2-yl)oxy]quinoline |
|---|---|
| PubChem CID | 82581132 |
| Molecular Formula | C13H13Cl2NO |
| Molecular Weight | 270.16 g/mol |
| Exact Mass | 269.04 |
| IUPAC Name | 2,4-dichloro-6-[(2-methylpropan-2-yl)oxy]quinoline |
| SMILES | CC(C)(C)Oc1ccc2nc(Cl)cc(Cl)c2c1 |
| InChI | InChI=1S/C13H13Cl2NO/c1-13(2,3)17-8-4-5-11-9(6-8)10(14)7-12(15)16-11/h4-7H,1-3H3 |
| InChIKey | UNWXWFUOFFXIDO-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.16 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|