C12H11Cl3N2 — CID 82581254
5,6,8-trichloro-N,N,2-trimethylquinolin-4-amine (PubChem CID 82581254) has the molecular formula C12H11Cl3N2 and a molecular weight of 289.59 g/mol. Its IUPAC name is 5,6,8-trichloro-N,N,2-trimethylquinolin-4-amine.
| Compound Name | 5,6,8-trichloro-N,N,2-trimethylquinolin-4-amine |
|---|---|
| PubChem CID | 82581254 |
| Molecular Formula | C12H11Cl3N2 |
| Molecular Weight | 289.59 g/mol |
| Exact Mass | 288.00 |
| IUPAC Name | 5,6,8-trichloro-N,N,2-trimethylquinolin-4-amine |
| SMILES | Cc1cc(N(C)C)c2c(Cl)c(Cl)cc(Cl)c2n1 |
| InChI | InChI=1S/C12H11Cl3N2/c1-6-4-9(17(2)3)10-11(15)7(13)5-8(14)12(10)16-6/h4-5H,1-3H3 |
| InChIKey | NKWGDEFUAFFJCS-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.59 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|