About 2-(5-amino-7-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)propanamide
2-(5-amino-7-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)propanamide (PubChem CID 82581731) has the molecular formula C12H16FN3O
and a molecular weight of 237.28 g/mol. Its IUPAC name is 2-(5-amino-7-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)propanamide.
Molecular Properties
| Compound Name | 2-(5-amino-7-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)propanamide |
| PubChem CID | 82581731 |
| Molecular Formula | C12H16FN3O |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | 2-(5-amino-7-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)propanamide |
| SMILES | CC(C(N)=O)N1CCc2c(N)cc(F)cc2C1 |
| InChI | InChI=1S/C12H16FN3O/c1-7(12(15)17)16-3-2-10-8(6-16)4-9(13)5-11(10)14/h4-5,7H,2-3,6,14H2,1H3,(H2,15,17) |
| InChIKey | RHTWZSZNJYZYEN-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-(5-amino-7-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-amino-7-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)propanamide?
The IUPAC name of 2-(5-amino-7-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)propanamide (CID 82581731) is 2-(5-amino-7-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)propanamide.
What is the SMILES notation for 2-(5-amino-7-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)propanamide?
The canonical SMILES for 2-(5-amino-7-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)propanamide is CC(C(N)=O)N1CCc2c(N)cc(F)cc2C1.
What is the InChIKey of 2-(5-amino-7-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)propanamide?
The InChIKey is RHTWZSZNJYZYEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16FN3O/c1-7(12(15)17)16-3-2-10-8(6-16)4-9(13)5-11(10)14/h4-5,7H,2-3,6,14H2,1H3,(H2,15,17).
What are the key properties of 2-(5-amino-7-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)propanamide?
2-(5-amino-7-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)propanamide has a molecular weight of 237.28 g/mol, XLogP of 0.64, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-amino-7-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)propanamide is sourced from PubChem (CID 82581731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).