C15H19NO4 — CID 82582321
2-(2,3,4,7,9,10-hexahydro-[1,4]dioxepino[2,3-g]isoquinolin-8-yl)propanoic acid (PubChem CID 82582321) has the molecular formula C15H19NO4 and a molecular weight of 277.32 g/mol. Its IUPAC name is 2-(2,3,4,7,9,10-hexahydro-[1,4]dioxepino[2,3-g]isoquinolin-8-yl)propanoic acid.
| Compound Name | 2-(2,3,4,7,9,10-hexahydro-[1,4]dioxepino[2,3-g]isoquinolin-8-yl)propanoic acid |
|---|---|
| PubChem CID | 82582321 |
| Molecular Formula | C15H19NO4 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | 2-(2,3,4,7,9,10-hexahydro-[1,4]dioxepino[2,3-g]isoquinolin-8-yl)propanoic acid |
| SMILES | CC(C(=O)O)N1CCc2cc3c(cc2C1)OCCCO3 |
| InChI | InChI=1S/C15H19NO4/c1-10(15(17)18)16-4-3-11-7-13-14(8-12(11)9-16)20-6-2-5-19-13/h7-8,10H,2-6,9H2,1H3,(H,17,18) |
| InChIKey | RVTXTJBGYRPMIP-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |