C19H23N3 — CID 82582743
7-(4-phenylpiperazin-1-yl)-1,2,3,4-tetrahydroisoquinoline (PubChem CID 82582743) has the molecular formula C19H23N3 and a molecular weight of 293.41 g/mol. Its IUPAC name is 7-(4-phenylpiperazin-1-yl)-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 7-(4-phenylpiperazin-1-yl)-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 82582743 |
| Molecular Formula | C19H23N3 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.19 |
| IUPAC Name | 7-(4-phenylpiperazin-1-yl)-1,2,3,4-tetrahydroisoquinoline |
| SMILES | c1ccc(N2CCN(c3ccc4c(c3)CNCC4)CC2)cc1 |
| InChI | InChI=1S/C19H23N3/c1-2-4-18(5-3-1)21-10-12-22(13-11-21)19-7-6-16-8-9-20-15-17(16)14-19/h1-7,14,20H,8-13,15H2 |
| InChIKey | PEEZGTQFAUREAZ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|