C16H13Cl2NO2 — CID 82583397
3-(5,6-dichloro-1,2,3,4-tetrahydroisoquinolin-8-yl)benzoic acid (PubChem CID 82583397) has the molecular formula C16H13Cl2NO2 and a molecular weight of 322.19 g/mol. Its IUPAC name is 3-(5,6-dichloro-1,2,3,4-tetrahydroisoquinolin-8-yl)benzoic acid.
| Compound Name | 3-(5,6-dichloro-1,2,3,4-tetrahydroisoquinolin-8-yl)benzoic acid |
|---|---|
| PubChem CID | 82583397 |
| Molecular Formula | C16H13Cl2NO2 |
| Molecular Weight | 322.19 g/mol |
| Exact Mass | 321.03 |
| IUPAC Name | 3-(5,6-dichloro-1,2,3,4-tetrahydroisoquinolin-8-yl)benzoic acid |
| SMILES | O=C(O)c1cccc(-c2cc(Cl)c(Cl)c3c2CNCC3)c1 |
| InChI | InChI=1S/C16H13Cl2NO2/c17-14-7-12(9-2-1-3-10(6-9)16(20)21)13-8-19-5-4-11(13)15(14)18/h1-3,6-7,19H,4-5,8H2,(H,20,21) |
| InChIKey | HSGJRRDZOPNQOI-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.19 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |