C15H16N2 — CID 82583605
3-methyl-5-pyridin-4-yl-1,2,3,4-tetrahydroisoquinoline (PubChem CID 82583605) has the molecular formula C15H16N2 and a molecular weight of 224.31 g/mol. Its IUPAC name is 3-methyl-5-pyridin-4-yl-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 3-methyl-5-pyridin-4-yl-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 82583605 |
| Molecular Formula | C15H16N2 |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 3-methyl-5-pyridin-4-yl-1,2,3,4-tetrahydroisoquinoline |
| SMILES | CC1Cc2c(cccc2-c2ccncc2)CN1 |
| InChI | InChI=1S/C15H16N2/c1-11-9-15-13(10-17-11)3-2-4-14(15)12-5-7-16-8-6-12/h2-8,11,17H,9-10H2,1H3 |
| InChIKey | RXQAJKFFFNIDFY-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |