C18H23N3 — CID 82584740
1-(aminomethyl)-N,2-dimethyl-N-phenyl-3,4-dihydro-1H-isoquinolin-4-amine (PubChem CID 82584740) has the molecular formula C18H23N3 and a molecular weight of 281.40 g/mol. Its IUPAC name is 1-(aminomethyl)-N,2-dimethyl-N-phenyl-3,4-dihydro-1H-isoquinolin-4-amine.
| Compound Name | 1-(aminomethyl)-N,2-dimethyl-N-phenyl-3,4-dihydro-1H-isoquinolin-4-amine |
|---|---|
| PubChem CID | 82584740 |
| Molecular Formula | C18H23N3 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.19 |
| IUPAC Name | 1-(aminomethyl)-N,2-dimethyl-N-phenyl-3,4-dihydro-1H-isoquinolin-4-amine |
| SMILES | CN1CC(N(C)c2ccccc2)c2ccccc2C1CN |
| InChI | InChI=1S/C18H23N3/c1-20-13-18(21(2)14-8-4-3-5-9-14)16-11-7-6-10-15(16)17(20)12-19/h3-11,17-18H,12-13,19H2,1-2H3 |
| InChIKey | VNVYROLRGQZZMP-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|