C18H20N2O2 — CID 82584938
4-methoxy-N-(7-methyl-1,2,3,4-tetrahydroisoquinolin-4-yl)benzamide (PubChem CID 82584938) has the molecular formula C18H20N2O2 and a molecular weight of 296.37 g/mol. Its IUPAC name is 4-methoxy-N-(7-methyl-1,2,3,4-tetrahydroisoquinolin-4-yl)benzamide.
| Compound Name | 4-methoxy-N-(7-methyl-1,2,3,4-tetrahydroisoquinolin-4-yl)benzamide |
|---|---|
| PubChem CID | 82584938 |
| Molecular Formula | C18H20N2O2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | 4-methoxy-N-(7-methyl-1,2,3,4-tetrahydroisoquinolin-4-yl)benzamide |
| SMILES | COc1ccc(C(=O)NC2CNCc3cc(C)ccc32)cc1 |
| InChI | InChI=1S/C18H20N2O2/c1-12-3-8-16-14(9-12)10-19-11-17(16)20-18(21)13-4-6-15(22-2)7-5-13/h3-9,17,19H,10-11H2,1-2H3,(H,20,21) |
| InChIKey | QLPBFPPURULXSS-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |