About 3-(1-benzyl-5-methyl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-3-yl)aniline
3-(1-benzyl-5-methyl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-3-yl)aniline (PubChem CID 82585997) has the molecular formula C20H22N4
and a molecular weight of 318.42 g/mol. Its IUPAC name is 3-(1-benzyl-5-methyl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-3-yl)aniline.
Molecular Properties
| Compound Name | 3-(1-benzyl-5-methyl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-3-yl)aniline |
| PubChem CID | 82585997 |
| Molecular Formula | C20H22N4 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | 3-(1-benzyl-5-methyl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-3-yl)aniline |
| SMILES | CN1CCc2c(c(-c3cccc(N)c3)nn2Cc2ccccc2)C1 |
| InChI | InChI=1S/C20H22N4/c1-23-11-10-19-18(14-23)20(16-8-5-9-17(21)12-16)22-24(19)13-15-6-3-2-4-7-15/h2-9,12H,10-11,13-14,21H2,1H3 |
| InChIKey | KMJZDVMKYNYDNQ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-(1-benzyl-5-methyl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-3-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-benzyl-5-methyl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-3-yl)aniline?
The IUPAC name of 3-(1-benzyl-5-methyl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-3-yl)aniline (CID 82585997) is 3-(1-benzyl-5-methyl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-3-yl)aniline.
What is the SMILES notation for 3-(1-benzyl-5-methyl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-3-yl)aniline?
The canonical SMILES for 3-(1-benzyl-5-methyl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-3-yl)aniline is CN1CCc2c(c(-c3cccc(N)c3)nn2Cc2ccccc2)C1.
What is the InChIKey of 3-(1-benzyl-5-methyl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-3-yl)aniline?
The InChIKey is KMJZDVMKYNYDNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22N4/c1-23-11-10-19-18(14-23)20(16-8-5-9-17(21)12-16)22-24(19)13-15-6-3-2-4-7-15/h2-9,12H,10-11,13-14,21H2,1H3.
What are the key properties of 3-(1-benzyl-5-methyl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-3-yl)aniline?
3-(1-benzyl-5-methyl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-3-yl)aniline has a molecular weight of 318.42 g/mol, XLogP of 3.17, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-benzyl-5-methyl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-3-yl)aniline is sourced from PubChem (CID 82585997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).