About methyl 2-[5-methyl-3-(phenoxymethyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-1-yl]acetate
methyl 2-[5-methyl-3-(phenoxymethyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-1-yl]acetate (PubChem CID 82586085) has the molecular formula C17H21N3O3
and a molecular weight of 315.37 g/mol. Its IUPAC name is methyl 2-[5-methyl-3-(phenoxymethyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-1-yl]acetate.
Molecular Properties
| Compound Name | methyl 2-[5-methyl-3-(phenoxymethyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-1-yl]acetate |
| PubChem CID | 82586085 |
| Molecular Formula | C17H21N3O3 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | methyl 2-[5-methyl-3-(phenoxymethyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-1-yl]acetate |
| SMILES | COC(=O)Cn1nc(COc2ccccc2)c2c1CCN(C)C2 |
| InChI | InChI=1S/C17H21N3O3/c1-19-9-8-16-14(10-19)15(18-20(16)11-17(21)22-2)12-23-13-6-4-3-5-7-13/h3-7H,8-12H2,1-2H3 |
| InChIKey | VRCFULWVDUDZAX-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 2-[5-methyl-3-(phenoxymethyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-1-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[5-methyl-3-(phenoxymethyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-1-yl]acetate?
The IUPAC name of methyl 2-[5-methyl-3-(phenoxymethyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-1-yl]acetate (CID 82586085) is methyl 2-[5-methyl-3-(phenoxymethyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-1-yl]acetate.
What is the SMILES notation for methyl 2-[5-methyl-3-(phenoxymethyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-1-yl]acetate?
The canonical SMILES for methyl 2-[5-methyl-3-(phenoxymethyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-1-yl]acetate is COC(=O)Cn1nc(COc2ccccc2)c2c1CCN(C)C2.
What is the InChIKey of methyl 2-[5-methyl-3-(phenoxymethyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-1-yl]acetate?
The InChIKey is VRCFULWVDUDZAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21N3O3/c1-19-9-8-16-14(10-19)15(18-20(16)11-17(21)22-2)12-23-13-6-4-3-5-7-13/h3-7H,8-12H2,1-2H3.
What are the key properties of methyl 2-[5-methyl-3-(phenoxymethyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-1-yl]acetate?
methyl 2-[5-methyl-3-(phenoxymethyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-1-yl]acetate has a molecular weight of 315.37 g/mol, XLogP of 1.62, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[5-methyl-3-(phenoxymethyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-1-yl]acetate is sourced from PubChem (CID 82586085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).