C16H13N5O2 — CID 82588991
2-[2-(4-aminophenyl)-[1,2,4]triazolo[1,5-a]benzimidazol-4-yl]acetic acid (PubChem CID 82588991) has the molecular formula C16H13N5O2 and a molecular weight of 307.31 g/mol. Its IUPAC name is 2-[2-(4-aminophenyl)-[1,2,4]triazolo[1,5-a]benzimidazol-4-yl]acetic acid.
| Compound Name | 2-[2-(4-aminophenyl)-[1,2,4]triazolo[1,5-a]benzimidazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 82588991 |
| Molecular Formula | C16H13N5O2 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | 2-[2-(4-aminophenyl)-[1,2,4]triazolo[1,5-a]benzimidazol-4-yl]acetic acid |
| SMILES | Nc1ccc(-c2nc3n(CC(=O)O)c4ccccc4n3n2)cc1 |
| InChI | InChI=1S/C16H13N5O2/c17-11-7-5-10(6-8-11)15-18-16-20(9-14(22)23)12-3-1-2-4-13(12)21(16)19-15/h1-8H,9,17H2,(H,22,23) |
| InChIKey | LQNTZJVQYPWVIL-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 98.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|