C13H9N5O2 — CID 82589132
1-[(2-nitrophenyl)methyl]imidazo[2,1-e]pyrazole-7-carbonitrile (PubChem CID 82589132) has the molecular formula C13H9N5O2 and a molecular weight of 267.25 g/mol. Its IUPAC name is 1-[(2-nitrophenyl)methyl]imidazo[2,1-e]pyrazole-7-carbonitrile.
| Compound Name | 1-[(2-nitrophenyl)methyl]imidazo[2,1-e]pyrazole-7-carbonitrile |
|---|---|
| PubChem CID | 82589132 |
| Molecular Formula | C13H9N5O2 |
| Molecular Weight | 267.25 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | 1-[(2-nitrophenyl)methyl]imidazo[2,1-e]pyrazole-7-carbonitrile |
| SMILES | N#Cc1cnn2ccn(Cc3ccccc3[N+](=O)[O-])c12 |
| InChI | InChI=1S/C13H9N5O2/c14-7-11-8-15-17-6-5-16(13(11)17)9-10-3-1-2-4-12(10)18(19)20/h1-6,8H,9H2 |
| InChIKey | GSODFXFUSSFLTP-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 89.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.25 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|