C18H19N3O3 — CID 825894
methyl 4-[[[2-(3-methylanilino)acetyl]hydrazinylidene]methyl]benzoate (PubChem CID 825894) has the molecular formula C18H19N3O3 and a molecular weight of 325.37 g/mol. Its IUPAC name is methyl 4-[[[2-(3-methylanilino)acetyl]hydrazinylidene]methyl]benzoate.
| Compound Name | methyl 4-[[[2-(3-methylanilino)acetyl]hydrazinylidene]methyl]benzoate |
|---|---|
| PubChem CID | 825894 |
| Molecular Formula | C18H19N3O3 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | methyl 4-[[[2-(3-methylanilino)acetyl]hydrazinylidene]methyl]benzoate |
| SMILES | COC(=O)c1ccc(C=NNC(=O)CNc2cccc(C)c2)cc1 |
| InChI | InChI=1S/C18H19N3O3/c1-13-4-3-5-16(10-13)19-12-17(22)21-20-11-14-6-8-15(9-7-14)18(23)24-2/h3-11,19H,12H2,1-2H3,(H,21,22) |
| InChIKey | RAJKIANAHBUIFA-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|