About (4aS,9aS)-10-methyl-4a,9a-dihydroacridin-9-one
(4aS,9aS)-10-methyl-4a,9a-dihydroacridin-9-one (PubChem CID 825903) has the molecular formula C14H13NO
and a molecular weight of 211.26 g/mol. Its IUPAC name is (4aS,9aS)-10-methyl-4a,9a-dihydroacridin-9-one.
Molecular Properties
| Compound Name | (4aS,9aS)-10-methyl-4a,9a-dihydroacridin-9-one |
| PubChem CID | 825903 |
| Molecular Formula | C14H13NO |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | (4aS,9aS)-10-methyl-4a,9a-dihydroacridin-9-one |
| SMILES | CN1c2ccccc2C(=O)[C@H]2C=CC=C[C@@H]21 |
| InChI | InChI=1S/C14H13NO/c1-15-12-8-4-2-6-10(12)14(16)11-7-3-5-9-13(11)15/h2-10,12H,1H3/t10-,12-/m0/s1 |
| InChIKey | LKBQKXBDNZMHJZ-JQWIXIFHSA-N |
| XLogP | 2.43 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4aS,9aS)-10-methyl-4a,9a-dihydroacridin-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4aS,9aS)-10-methyl-4a,9a-dihydroacridin-9-one?
The IUPAC name of (4aS,9aS)-10-methyl-4a,9a-dihydroacridin-9-one (CID 825903) is (4aS,9aS)-10-methyl-4a,9a-dihydroacridin-9-one.
What is the SMILES notation for (4aS,9aS)-10-methyl-4a,9a-dihydroacridin-9-one?
The canonical SMILES for (4aS,9aS)-10-methyl-4a,9a-dihydroacridin-9-one is CN1c2ccccc2C(=O)[C@H]2C=CC=C[C@@H]21.
What is the InChIKey of (4aS,9aS)-10-methyl-4a,9a-dihydroacridin-9-one?
The InChIKey is LKBQKXBDNZMHJZ-JQWIXIFHSA-N. The full InChI is InChI=1S/C14H13NO/c1-15-12-8-4-2-6-10(12)14(16)11-7-3-5-9-13(11)15/h2-10,12H,1H3/t10-,12-/m0/s1.
What are the key properties of (4aS,9aS)-10-methyl-4a,9a-dihydroacridin-9-one?
(4aS,9aS)-10-methyl-4a,9a-dihydroacridin-9-one has a molecular weight of 211.26 g/mol, XLogP of 2.43, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4aS,9aS)-10-methyl-4a,9a-dihydroacridin-9-one is sourced from PubChem (CID 825903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).