C15H13N5O — CID 82590328
1-(4-methoxyphenyl)-3H-[1,2,4]triazolo[4,3-a]benzimidazol-7-amine (PubChem CID 82590328) has the molecular formula C15H13N5O and a molecular weight of 279.30 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-3H-[1,2,4]triazolo[4,3-a]benzimidazol-7-amine.
| Compound Name | 1-(4-methoxyphenyl)-3H-[1,2,4]triazolo[4,3-a]benzimidazol-7-amine |
|---|---|
| PubChem CID | 82590328 |
| Molecular Formula | C15H13N5O |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | 1-(4-methoxyphenyl)-3H-[1,2,4]triazolo[4,3-a]benzimidazol-7-amine |
| SMILES | COc1ccc(-c2n[nH]c3nc4ccc(N)cc4n23)cc1 |
| InChI | InChI=1S/C15H13N5O/c1-21-11-5-2-9(3-6-11)14-18-19-15-17-12-7-4-10(16)8-13(12)20(14)15/h2-8H,16H2,1H3,(H,17,19) |
| InChIKey | FRPDUBPYDSPJEH-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 81.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|