About 3-cyclopropyl-1-(2,6-difluorophenyl)-6,7-dihydro-5H-indazol-4-one
3-cyclopropyl-1-(2,6-difluorophenyl)-6,7-dihydro-5H-indazol-4-one (PubChem CID 82590928) has the molecular formula C16H14F2N2O
and a molecular weight of 288.30 g/mol. Its IUPAC name is 3-cyclopropyl-1-(2,6-difluorophenyl)-6,7-dihydro-5H-indazol-4-one.
Molecular Properties
| Compound Name | 3-cyclopropyl-1-(2,6-difluorophenyl)-6,7-dihydro-5H-indazol-4-one |
| PubChem CID | 82590928 |
| Molecular Formula | C16H14F2N2O |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 3-cyclopropyl-1-(2,6-difluorophenyl)-6,7-dihydro-5H-indazol-4-one |
| SMILES | O=C1CCCc2c1c(C1CC1)nn2-c1c(F)cccc1F |
| InChI | InChI=1S/C16H14F2N2O/c17-10-3-1-4-11(18)16(10)20-12-5-2-6-13(21)14(12)15(19-20)9-7-8-9/h1,3-4,9H,2,5-8H2 |
| InChIKey | KDEZTANWZZOVRW-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-cyclopropyl-1-(2,6-difluorophenyl)-6,7-dihydro-5H-indazol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclopropyl-1-(2,6-difluorophenyl)-6,7-dihydro-5H-indazol-4-one?
The IUPAC name of 3-cyclopropyl-1-(2,6-difluorophenyl)-6,7-dihydro-5H-indazol-4-one (CID 82590928) is 3-cyclopropyl-1-(2,6-difluorophenyl)-6,7-dihydro-5H-indazol-4-one.
What is the SMILES notation for 3-cyclopropyl-1-(2,6-difluorophenyl)-6,7-dihydro-5H-indazol-4-one?
The canonical SMILES for 3-cyclopropyl-1-(2,6-difluorophenyl)-6,7-dihydro-5H-indazol-4-one is O=C1CCCc2c1c(C1CC1)nn2-c1c(F)cccc1F.
What is the InChIKey of 3-cyclopropyl-1-(2,6-difluorophenyl)-6,7-dihydro-5H-indazol-4-one?
The InChIKey is KDEZTANWZZOVRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14F2N2O/c17-10-3-1-4-11(18)16(10)20-12-5-2-6-13(21)14(12)15(19-20)9-7-8-9/h1,3-4,9H,2,5-8H2.
What are the key properties of 3-cyclopropyl-1-(2,6-difluorophenyl)-6,7-dihydro-5H-indazol-4-one?
3-cyclopropyl-1-(2,6-difluorophenyl)-6,7-dihydro-5H-indazol-4-one has a molecular weight of 288.30 g/mol, XLogP of 3.55, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopropyl-1-(2,6-difluorophenyl)-6,7-dihydro-5H-indazol-4-one is sourced from PubChem (CID 82590928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).