2-(3-cyclopropyl-4,5,6,7-tetrahydro-1H-indazol-4-yl)acetic acid

C12H16N2O2 — CID 82591675

IUPAC2-(3-cyclopropyl-4,5,6,7-tetrahydro-1H-indazol-4-yl)acetic acid
SMILESO=C(O)CC1CCCc2[nH]nc(C3CC3)c21
InChIInChI=1S/C12H16N2O2/c15-10(16)6-8-2-1-3-9-11(8)12(14-13-9)7-4-5-7/h7-8H,1-6H2,(H,13,14)(H,15,16)
InChIKeyQRIQXAVSFKTYGO-UHFFFAOYSA-N
MW220.27 g/mol
LogP2.18
Rot. Bonds3

About 2-(3-cyclopropyl-4,5,6,7-tetrahydro-1H-indazol-4-yl)acetic acid

2-(3-cyclopropyl-4,5,6,7-tetrahydro-1H-indazol-4-yl)acetic acid (PubChem CID 82591675) has the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. Its IUPAC name is 2-(3-cyclopropyl-4,5,6,7-tetrahydro-1H-indazol-4-yl)acetic acid.

Molecular Properties

Compound Name2-(3-cyclopropyl-4,5,6,7-tetrahydro-1H-indazol-4-yl)acetic acid
PubChem CID82591675
Molecular FormulaC12H16N2O2
Molecular Weight220.27 g/mol
Exact Mass220.12
IUPAC Name2-(3-cyclopropyl-4,5,6,7-tetrahydro-1H-indazol-4-yl)acetic acid
SMILESO=C(O)CC1CCCc2[nH]nc(C3CC3)c21
InChIInChI=1S/C12H16N2O2/c15-10(16)6-8-2-1-3-9-11(8)12(14-13-9)7-4-5-7/h7-8H,1-6H2,(H,13,14)(H,15,16)
InChIKeyQRIQXAVSFKTYGO-UHFFFAOYSA-N
XLogP2.18
TPSA65.98 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500220.27
LogP ≤ 52.18
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-(3-cyclopropyl-4,5,6,7-tetrahydro-1H-indazol-4-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3-cyclopropyl-4,5,6,7-tetrahydro-1H-indazol-4-yl)acetic acid?
The IUPAC name of 2-(3-cyclopropyl-4,5,6,7-tetrahydro-1H-indazol-4-yl)acetic acid (CID 82591675) is 2-(3-cyclopropyl-4,5,6,7-tetrahydro-1H-indazol-4-yl)acetic acid.
What is the SMILES notation for 2-(3-cyclopropyl-4,5,6,7-tetrahydro-1H-indazol-4-yl)acetic acid?
The canonical SMILES for 2-(3-cyclopropyl-4,5,6,7-tetrahydro-1H-indazol-4-yl)acetic acid is O=C(O)CC1CCCc2[nH]nc(C3CC3)c21.
What is the InChIKey of 2-(3-cyclopropyl-4,5,6,7-tetrahydro-1H-indazol-4-yl)acetic acid?
The InChIKey is QRIQXAVSFKTYGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O2/c15-10(16)6-8-2-1-3-9-11(8)12(14-13-9)7-4-5-7/h7-8H,1-6H2,(H,13,14)(H,15,16).
What are the key properties of 2-(3-cyclopropyl-4,5,6,7-tetrahydro-1H-indazol-4-yl)acetic acid?
2-(3-cyclopropyl-4,5,6,7-tetrahydro-1H-indazol-4-yl)acetic acid has a molecular weight of 220.27 g/mol, XLogP of 2.18, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-cyclopropyl-4,5,6,7-tetrahydro-1H-indazol-4-yl)acetic acid is sourced from PubChem (CID 82591675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).