2-(3-cyclohexyl-4,5,6,7-tetrahydro-1H-indazol-4-yl)acetic acid

C15H22N2O2 — CID 82591682

IUPAC2-(3-cyclohexyl-4,5,6,7-tetrahydro-1H-indazol-4-yl)acetic acid
SMILESO=C(O)CC1CCCc2[nH]nc(C3CCCCC3)c21
InChIInChI=1S/C15H22N2O2/c18-13(19)9-11-7-4-8-12-14(11)15(17-16-12)10-5-2-1-3-6-10/h10-11H,1-9H2,(H,16,17)(H,18,19)
InChIKeyAPWMNUXTQMYWCB-UHFFFAOYSA-N
MW262.35 g/mol
LogP3.35
Rot. Bonds3

About 2-(3-cyclohexyl-4,5,6,7-tetrahydro-1H-indazol-4-yl)acetic acid

2-(3-cyclohexyl-4,5,6,7-tetrahydro-1H-indazol-4-yl)acetic acid (PubChem CID 82591682) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is 2-(3-cyclohexyl-4,5,6,7-tetrahydro-1H-indazol-4-yl)acetic acid.

Molecular Properties

Compound Name2-(3-cyclohexyl-4,5,6,7-tetrahydro-1H-indazol-4-yl)acetic acid
PubChem CID82591682
Molecular FormulaC15H22N2O2
Molecular Weight262.35 g/mol
Exact Mass262.17
IUPAC Name2-(3-cyclohexyl-4,5,6,7-tetrahydro-1H-indazol-4-yl)acetic acid
SMILESO=C(O)CC1CCCc2[nH]nc(C3CCCCC3)c21
InChIInChI=1S/C15H22N2O2/c18-13(19)9-11-7-4-8-12-14(11)15(17-16-12)10-5-2-1-3-6-10/h10-11H,1-9H2,(H,16,17)(H,18,19)
InChIKeyAPWMNUXTQMYWCB-UHFFFAOYSA-N
XLogP3.35
TPSA65.98 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500262.35
LogP ≤ 53.35
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-(3-cyclohexyl-4,5,6,7-tetrahydro-1H-indazol-4-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3-cyclohexyl-4,5,6,7-tetrahydro-1H-indazol-4-yl)acetic acid?
The IUPAC name of 2-(3-cyclohexyl-4,5,6,7-tetrahydro-1H-indazol-4-yl)acetic acid (CID 82591682) is 2-(3-cyclohexyl-4,5,6,7-tetrahydro-1H-indazol-4-yl)acetic acid.
What is the SMILES notation for 2-(3-cyclohexyl-4,5,6,7-tetrahydro-1H-indazol-4-yl)acetic acid?
The canonical SMILES for 2-(3-cyclohexyl-4,5,6,7-tetrahydro-1H-indazol-4-yl)acetic acid is O=C(O)CC1CCCc2[nH]nc(C3CCCCC3)c21.
What is the InChIKey of 2-(3-cyclohexyl-4,5,6,7-tetrahydro-1H-indazol-4-yl)acetic acid?
The InChIKey is APWMNUXTQMYWCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N2O2/c18-13(19)9-11-7-4-8-12-14(11)15(17-16-12)10-5-2-1-3-6-10/h10-11H,1-9H2,(H,16,17)(H,18,19).
What are the key properties of 2-(3-cyclohexyl-4,5,6,7-tetrahydro-1H-indazol-4-yl)acetic acid?
2-(3-cyclohexyl-4,5,6,7-tetrahydro-1H-indazol-4-yl)acetic acid has a molecular weight of 262.35 g/mol, XLogP of 3.35, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-cyclohexyl-4,5,6,7-tetrahydro-1H-indazol-4-yl)acetic acid is sourced from PubChem (CID 82591682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).