C16H18N4 — CID 82592040
2-[3-(4-aminophenyl)-1-methyl-4,5,6,7-tetrahydroindazol-4-yl]acetonitrile (PubChem CID 82592040) has the molecular formula C16H18N4 and a molecular weight of 266.35 g/mol. Its IUPAC name is 2-[3-(4-aminophenyl)-1-methyl-4,5,6,7-tetrahydroindazol-4-yl]acetonitrile.
| Compound Name | 2-[3-(4-aminophenyl)-1-methyl-4,5,6,7-tetrahydroindazol-4-yl]acetonitrile |
|---|---|
| PubChem CID | 82592040 |
| Molecular Formula | C16H18N4 |
| Molecular Weight | 266.35 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 2-[3-(4-aminophenyl)-1-methyl-4,5,6,7-tetrahydroindazol-4-yl]acetonitrile |
| SMILES | Cn1nc(-c2ccc(N)cc2)c2c1CCCC2CC#N |
| InChI | InChI=1S/C16H18N4/c1-20-14-4-2-3-11(9-10-17)15(14)16(19-20)12-5-7-13(18)8-6-12/h5-8,11H,2-4,9,18H2,1H3 |
| InChIKey | IGIYXMLIDQLGHX-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 67.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.35 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|