C17H23N3 — CID 82592089
3-(4-tert-butylphenyl)-4,5,6,7-tetrahydro-1H-indazol-4-amine (PubChem CID 82592089) has the molecular formula C17H23N3 and a molecular weight of 269.39 g/mol. Its IUPAC name is 3-(4-tert-butylphenyl)-4,5,6,7-tetrahydro-1H-indazol-4-amine.
| Compound Name | 3-(4-tert-butylphenyl)-4,5,6,7-tetrahydro-1H-indazol-4-amine |
|---|---|
| PubChem CID | 82592089 |
| Molecular Formula | C17H23N3 |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.19 |
| IUPAC Name | 3-(4-tert-butylphenyl)-4,5,6,7-tetrahydro-1H-indazol-4-amine |
| SMILES | CC(C)(C)c1ccc(-c2n[nH]c3c2C(N)CCC3)cc1 |
| InChI | InChI=1S/C17H23N3/c1-17(2,3)12-9-7-11(8-10-12)16-15-13(18)5-4-6-14(15)19-20-16/h7-10,13H,4-6,18H2,1-3H3,(H,19,20) |
| InChIKey | SGHPNIKTFMVABH-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |