C14H18N4 — CID 82592105
3-(3-aminophenyl)-1-methyl-4,5,6,7-tetrahydroindazol-4-amine (PubChem CID 82592105) has the molecular formula C14H18N4 and a molecular weight of 242.33 g/mol. Its IUPAC name is 3-(3-aminophenyl)-1-methyl-4,5,6,7-tetrahydroindazol-4-amine.
| Compound Name | 3-(3-aminophenyl)-1-methyl-4,5,6,7-tetrahydroindazol-4-amine |
|---|---|
| PubChem CID | 82592105 |
| Molecular Formula | C14H18N4 |
| Molecular Weight | 242.33 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | 3-(3-aminophenyl)-1-methyl-4,5,6,7-tetrahydroindazol-4-amine |
| SMILES | Cn1nc(-c2cccc(N)c2)c2c1CCCC2N |
| InChI | InChI=1S/C14H18N4/c1-18-12-7-3-6-11(16)13(12)14(17-18)9-4-2-5-10(15)8-9/h2,4-5,8,11H,3,6-7,15-16H2,1H3 |
| InChIKey | JORWJJORBFKAHF-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 69.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.33 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|